4-(Bromomethyl)phenyl isothiocyanate
Hetero-bifunctional linker specially for the quaternisation of pyridyl-nitrogen in order to introduce an amine or thiol reactive group. Synthetic building block for the preparation of fluorescent labels.
| Catalog Number | CDX-B0091-M025 |
| Alternative Name(s) | 1-(Bromomethyl)-4-isothiocyanatobenzene; 4-Isothiocyanatobenzyl bromide |
| Research Area | Biochemicals, Immunology |
| Molecular Formula | C8H6BrNS |
| CAS# | 155863-32-4 |
| Purity | >98% |
| Inchi | InChI=1S/C8H6BrNS/c9-5-7-1-3-8(4-2-7)10-6-11/h1-4H,5H2 |
| Inchi Key | NSQGUALFBVTBHL-UHFFFAOYSA-N |
| SMILES | BrCC1=CC=C(C=C1)N=C=S |
| Size | 25 mg |
| Supplier Page | http://www.adipogen.com/cdx-b0091/4-bromomethyl-phenyl-isothiocyanate.html |
