Xylidyl blue I
Colorimetric reagent for Mg detection. The aqueous solution of XB-1 is red, and turns reddish-violet in the presence of Mg at pH 9 (maximum wavelength: 510 nm, molar absorptivity: 49,000, detection range 0.02-0.4 ppm).
| Catalog Number | CDX-X0009-G025 |
| Alternative Name(s) | XB-I; Magonsulfonate; 4-Hydroxy-3-[2-hydroxy-3-(2,4-dimethylphenylaminocarbonyl)-1-naphthylazobenzenesulfonic acid sodium salt |
| Research Area | Biochemicals, Immunology |
| Molecular Formula | C25H20N3NaO6S |
| CAS# | 14936-97-1 |
| Purity | >88% |
| Inchi | InChI=1S/C25H21N3O6S.Na/c1-14-7-9-20(15(2)11-14)26-25(31)19-12-16-5-3-4-6-18(16)23(24(19)30)28-27-21-13-17(35(32,33)34)8-10-22(21)29;/h3-13,29-30H,1-2H3,(H,26,31)(H,32,33,34);/q;+1/p-1/b28-27+; |
| Inchi Key | LKSHJHJGLORTGD-RXQWRGDBSA-M |
| SMILES | [Na+].CC1=CC=C(NC(=O)C2=CC3=CC=CC=C3C(N=NC3=CC(=CC=C3O)S([O-])(=O)=O)=C2O)C(C)=C1 |
| Size | 25 g |
| Supplier Page | http://www.adipogen.com/cdx-x0009/xylidyl-blue-i.html |