N-(3-Oxodecanoyl)-L-homoserine lactone
N-(3-Oxodecanoyl)-DL-homoserine lactone is a small diffusible signaling molecule and is a member of N-acyl-homoserine lactone family. N-acylhomoserine lactones (AHL) are involved in quorum sensing, controlling gene expression, and cellular metabolism. The diverse applications of this kind of molecule include regulation of virulence in general, infection prevention, and formation of biofilms. It was used as an autoinducer of quorum signaling by Pseudomonas putida, Yersinia enterocolitica and other Gram-negative bacteria.
| Catalog Number | CDX-O0059-M100 |
| Alternative Name(s) | 3-oxo-C10-HSL; 3OC10-HSL; 3-oxo-N-[(3S)-Tetrahydro-2-oxo-3-furanyl]-decanamide |
| Research Area | Biochemicals, Inflammation |
| Molecular Formula | C14H23NO4 |
| CAS# | 147795-40-2 |
| Purity | >97% |
| Inchi | InChI=1S/C14H23NO4/c1-2-3-4-5-6-7-11(16)10-13(17)15-12-8-9-19-14(12)18/h12H,2-10H2,1H3,(H,15,17)/t12-/m0/s1 |
| Inchi Key | KYGIKEQVUKTKRR-LBPRGKRZSA-N |
| SMILES | [H][C@@]1(CCOC1=O)NC(=O)CC(=O)CCCCCCC |
| Size | 100 mg |
| Supplier Page | http://www.adipogen.com/cdx-o0059/n-3-oxodecanoyl-l-homoserine-lactone.html |
