Potassium tetrakis(4-chlorophenyl)borate
Lipophilic anionic additive, used together with selective ionophores. The ionophore is the ion carrier which reversibly binds ions and transports them across the hydrophobic membrane. The ionic additive K-TCPB, catalyzes the ion-exchange process at the sample/membrane interface.
| Catalog Number | CDX-P0134-G005 |
| Alternative Name(s) | Tetrakis(4-chlorophenyl)boron potassium; K-TCPB |
| Research Area | Biochemicals, Immunology |
| Molecular Formula | C24H16BCl4K |
| CAS# | 14680-77-4 |
| Purity | >98% |
| Inchi | InChI=1S/C24H16BCl4.K/c26-21-9-1-17(2-10-21)25(18-3-11-22(27)12-4-18,19-5-13-23(28)14-6-19)20-7-15-24(29)16-8-20;/h1-16H;/q-1;+1 |
| Inchi Key | SAGICZRAKJSWLD-UHFFFAOYSA-N |
| SMILES | [K+].ClC1=CC=C(C=C1)[B-](C1=CC=C(Cl)C=C1)(C1=CC=C(Cl)C=C1)C1=CC=C(Cl)C=C1 |
| Size | 5 g |
| Supplier Page | http://www.adipogen.com/cdx-p0134/potassium-tetrakis-4-chlorophenyl-borate.html |