DABPH
Cell permeable, potent and selective class IIb HDAC6 inhibitor (IC50 =12nM). Displays high selectivity over HDAC1 (IC50=6.8µM). Neuroprotective. Effectively prevents neuronal cell death upon oxidative stress induction by HCA and selectively induces cellular alpha-tubulin hyperacetylation. HDAC6 deacetylates tubulin, HSP90 and the core histones (H2A, H2B, H3, H4). Histone deacetylases act via the formation of large multiprotein complexes. HDAC6 plays an important role in microtubule-dependent cell motility, transcriptional regulation, degradation of misfolded proteins and cell cycle and is involved in autophagy, inflammation, cancer and neurodegeneration.
| Catalog Number | AG-CR1-3906-M001 |
| Alternative Name(s) | 4-(4-(Dimethylamino)benzyl)-N-hydroxybenzamide |
| Research Area | Biochemicals, Cancer, Inflammation, Neurodegenerative Disease |
| Molecular Formula | C16H18N2O2 |
| CAS# | 1392835-67-4 |
| Purity | >98% |
| Inchi | InChI=1S/C16H18N2O2/c1-18(2)15-9-5-13(6-10-15)11-12-3-7-14(8-4-12)16(19)17-20/h3-10,20H,11H2,1-2H3,(H,17,19) |
| Inchi Key | MNOOUMMGNAQTKF-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(CC2=CC=C(C=C2)C(=O)NO)C=C1 |
| Size | 1 mg |
| Supplier Page | http://www.adipogen.com/ag-cr1-3906/dabph.html |
