Bisindolylmaleimide IX . methansulfonate [Ro 31-8220]
Selective and cell permeable protein kinase C (PKC) inhibitor. Inhibits the stimulation of insulin secretion by glucose. Inhibits T cell activation. Apoptosis inducer. Potent glycogen synthase kinase-3 (GSK-3) inhibitor. Transcription inhibitor. Induces TNF receptor family-mediated cell death. Pim-1 kinase inhibitor. Antitumor compound.
| Catalog Number | AG-CR1-0111-M001 |
| Alternative Name(s) | Ro 31-8220; BIM IX |
| Research Area | Apoptosis, Biochemicals, Cancer, Cell Death, Inflammation, Metabolism |
| Molecular Formula | C25H23N5O2S . CH4O3S |
| CAS# | 138489-18-6 |
| Purity | >98% |
| Inchi | InChI=1S/C25H23N5O2S.CH4O3S/c1-29-13-17(15-7-2-4-9-19(15)29)21-22(24(32)28-23(21)31)18-14-30(11-6-12-33-25(26)27)20-10-5-3-8-16(18)20;1-5(2,3)4/h2-5,7-10,13-14H,6,11-12H2,1H3,(H3,26,27)(H,28,31,32);1H3,(H,2,3,4) |
| Inchi Key | SAWVGDJBSPLRRB-UHFFFAOYSA-N |
| SMILES | CS(O)(=O)=O.CN1C=C(C2=C1C=CC=C2)C1=C(C(=O)NC1=O)C1=CN(CCCSC(N)=N)C2=C1C=CC=C2 |
| Size | 1 mg |
| Supplier Page | http://www.adipogen.com/ag-cr1-0111/bisindolylmaleimide-ix-methanesulfonate.html |
