(-)-Viriditoxin
Antibiotic. Exhibits broad activity against Gram-positive bacteria. Bacterial cell division protein FtsZ inhibitor (IC50=8.2µg/ml). Inhibits the GTPase activity of FtsZ in vitro (IC50=7.0µg/ml). Induces apoptosis and autophagy and inhibits cell growth at G2/M in human prostate cancer cells. Activates ATP hydrolysis and induces calcium sensitized swelling of rat liver mitochondria.
| Catalog Number | AG-CN2-0471-C500 |
| Alternative Name(s) | (M)-Viriditoxin; SC-28762 |
| Research Area | Apoptosis, Autophagy, Biochemicals, Cancer, Inflammation, Natural Products |
| Molecular Formula | C34H30O14 |
| CAS# | 1381782-08-6 |
| Purity | >98% |
| Inchi | InChI=1S/C34H30O14/c1-43-21-11-19(35)27-17(7-13-5-15(9-23(37)45-3)47-33(41)25(13)31(27)39)29(21)30-18-8-14-6-16(10-24(38)46-4)48-34(42)26(14)32(40)28(18)20(36)12-22(30)44-2/h7-8,11-12,15-16,35-36,39-40H,5-6,9-10H2,1-4H3/t15-,16-/m0/s1 |
| Inchi Key | GMCZVCXZGZGZPX-HOTGVXAUSA-N |
| SMILES | COC(=O)C[C@@H]1CC2=CC3=C(C(O)=CC(OC)=C3C3=C4C=C5C[C@@H](CC(=O)OC)OC(=O)C5=C(O)C4=C(O)C=C3OC)C(O)=C2C(=O)O1 |
| Size | 500 µg |
| Supplier Page | http://www.adipogen.com/ag-cn2-0471/-viriditoxin.html |
