3,6-Dichlorotrimellitic acid
Key precursor used for preparation of a variety of dichlorinated fluoresceins and rhodamines such as TET and HEX. These chlorinated fluoresceins and rhodamines are widely used for labeling oligos and in DNA sequencing.
| Catalog Number | CDX-D0268-G001 |
| Alternative Name(s) | 2,5-Dichloro-1,3,4-benzenetricarboxylic acid |
| Research Area | Biochemicals |
| Molecular Formula | C9H4Cl2O6 |
| CAS# | 137071-78-4 |
| Purity | >97% |
| Inchi | InChI=1S/C9H4Cl2O6/c10-3-1-2(7(12)13)6(11)5(9(16)17)4(3)8(14)15/h1H,(H,12,13)(H,14,15)(H,16,17) |
| Inchi Key | WFLALXNBVTWGKP-UHFFFAOYSA-N |
| SMILES | OC(=O)C1=C(Cl)C(C(O)=O)=C(C(O)=O)C(Cl)=C1 |
| Size | 1 g |
| Supplier Page | http://www.adipogen.com/cdx-d0268/3-6-dichlorotrimellitic-acid.html |