Rhodamine 110 chloride
Fluorescent dye. Fluorophore standard that is widely used in enzyme assay systems. Precursor for a variety of R110-based enzyme substrates for flow cytometric measurements. Used as a calibration standard for R110-based enzyme substrates. Compared to AMC and AFC enzyme substrates, fluorogenic R110 substrates are generally more sensitive, giving longer absorption and fluorescence wavelength than AMC and AFC substrates. Spectral data: lambdaex 498nm| lambdaem 520nm in methanol.
| Catalog Number | CDX-R0016-G001 |
| Alternative Name(s) | RH110; Rhodamine 560 Chloride; Rhodamine N; 3,6-Diamino-9-(2-carboxyphenyl)xanthylium chloride |
| Research Area | Biochemicals, Immunology |
| Molecular Formula | C20H14N2O3 . HCl |
| CAS# | 13558-31-1 |
| Purity | >97% |
| Inchi | InChI=1S/C20H14N2O3.ClH/c21-11-5-7-15-17(9-11)25-18-10-12(22)6-8-16(18)19(15)13-3-1-2-4-14(13)20(23)24;/h1-10,21H,22H2,(H,23,24);1H |
| Inchi Key | JNGRENQDBKMCCR-UHFFFAOYSA-N |
| SMILES | Cl.NC1=CC=C2C(OC3=CC(=N)C=CC3=C2C2=C(C=CC=C2)C(O)=O)=C1 |
| Size | 1 g |
| Supplier Page | http://www.adipogen.com/cdx-r0016/rhodamine-110-chloride.html |