Epoxomicin
Antibiotic. Potent anticancer compound. Cell permeable, potent, selective and irreversible 20S proteasome inhibitor. Predominantly inhibits the chymotrypsin-like (CTRL) activity of the proteasome. Exhibits lower level inhibition of proteasome trypsin-like and caspase-like activitives (100 and 1,000-fold slower rates respectively). Anti-inflammatory. Antimicrobial and antimalarial. Anti-parasitic. Stimulates bone formation by inhibiting osteoblast proteasome activity. Induces Parkinson’s-like symptoms in rats. The ubiquitin-proteasome system (UPS) and autophagy serve as two complementary, reciprocally regulated protein degradation systems. Blockade of UPS by Epoxomicin activates autophagy.
| Catalog Number | AG-CN2-0422-C250 |
| Alternative Name(s) | Antibiotic BU 4061T |
| Research Area | Autophagy, Biochemicals |
| Molecular Formula | C28H50N4O7 |
| CAS# | 134381-21-8 |
| Purity | >97% |
| Inchi | InChI=1S/C28H50N4O7/c1-11-16(5)21(30-27(38)23(17(6)12-2)32(10)19(8)34)25(36)31-22(18(7)33)26(37)29-20(13-15(3)4)24(35)28(9)14-39-28/h15-18,20-23,33H,11-14H2,1-10H3,(H,29,37)(H,30,38)(H,31,36)/t16-,17-,18+,20-,21-,22-,23-,28+/m0/s1 |
| Inchi Key | DOGIDQKFVLKMLQ-JTHVHQAWSA-N |
| SMILES | CC[C@H](C)[C@H](NC(=O)[C@H]([C@@H](C)CC)N(C)C(C)=O)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CC(C)C)C(=O)[C@@]1(C)CO1 |
| Size | 250 µg |
| Supplier Page | http://www.adipogen.com/ag-cn2-0422/epoxomicin.html |
