1,2,3-Tris(diethylamino)cyclopropenylium bis(trifluoromethanesulfonyl)imide
Air- and water-stable ionic liquid. The properties of these ionic liquids include almost zero vapour pressure, low flammability and ease of recycling. They are frequently considered as potential green alternatives to classical organic solvents. Additionally, most classes can be readily tuned to provide unique solvent environments in which to carry out reactions, extractions and other processes. There are a large number of applications.
Catalog Number | CDX-T0091-G005 |
Research Area | Biochemicals, Immunology |
Molecular Formula | C17H30F6N4O4S2 |
CAS# | 1333477-58-9 |
Purity | >97% |
Inchi | InChI=1S/C15H30N3.C2F6NO4S2/c1-7-16(8-2)13-14(17(9-3)10-4)15(13)18(11-5)12-6;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h7-12H2,1-6H3;/q+1;-1 |
Inchi Key | SWRHBXSDADDWGZ-UHFFFAOYSA-N |
SMILES | FC(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F.CCN(CC)C1=C(N(CC)CC)C1=[N+](CC)CC |
Size | 5 g |
Supplier Page | http://www.adipogen.com/cdx-t0091/1-2-3-tris-diethylamino-cyclopropenylium-bis-trifluoromethanesulfonyl-imide.html |