Quinine (anhydrous)
Because of its relatively constant and well-known fluorescence quantum yield, quinine is also used in photochemistry as a common fluorescence standard. It has been used for imaging of oxygen evolution and oxide formation. Chloride and bromide have been shown to quench fluorescence. Generally it is famous as potassium channel blocker with antipyretic (fever-reducing), antimalarial, analgesic (painkilling), and anti-inflammatory properties.
![](https://smallmolecules.com/sm/wp-content/uploads/2017/04/image_375.png)
Catalog Number | CDX-Q0012-G005 |
Research Area | Biochemicals, Immunology |
Molecular Formula | C20H24N2O2 |
CAS# | 130-95-0 |
Purity | >98% |
Inchi | InChI=1S/C20H24N2O2/c1-3-13-12-22-9-7-14(13)10-19(22)20(23)16-6-8-21-18-5-4-15(24-2)11-17(16)18/h3-6,8,11,13-14,19-20,23H,1,7,9-10,12H2,2H3/t13-,14-,19?,20+/m0/s1 |
Inchi Key | LOUPRKONTZGTKE-KRLTWTMGSA-N |
SMILES | [H][C@@]12CCN(C[C@@H]1C=C)C(C2)[C@H](O)C1=C2C=C(OC)C=CC2=NC=C1 |
Size | 5 g |
Supplier Page | http://www.adipogen.com/cdx-q0012/quinine-anhydrous.html |