Y-27632 . dihydrochloride
Potent, cell permeable, selective and ATP-competitive Rho-associated protein kinases inhibitor, including p160ROCK, ROCK-II and PRK2 inhibitor. Tumor cell invasion and metastasis suppressor. Smooth muscle relaxant. Decreases liver fibrosis by hepatic stellate cell growth inhibition. Antinociceptive. Blocks generation of inflammatory cytokines. Stem cell research modulator. Prevents apoptosis and enhances the survival and cloning efficiency of dissociated human embryonic stem (hES) cells without affecting their pluripotency. Increases survival rate of hES cells undergoing cryopreservation.
| Catalog Number | AG-CR1-3564-M025 |
| Alternative Name(s) | (R)-(+)-trans-4-(1-Aminoethyl)-N-(4-pyridyl)cyclohexanecarboxamide dihydrochloride |
| Research Area | Apoptosis, Biochemicals, Cancer, Immunology, Inflammation, Stem Cell Research |
| Molecular Formula | C14H21N3O . 2HCl |
| CAS# | 129830-38-2 | 146986-50-7 (free base) |
| Purity | >98% |
| Inchi | InChi=1S/C14H21N3O/c1-10(15)11-2-4-12(5-3-11)14(18)17-13-6-8-16-9-7-13/h6-12H,2-5,15H2,1H3,(H,16,17,18)/t10-,11?,12?/m1/s1 |
| Inchi Key | IYOZTVGMEWJPKR-VOMCLLRMSA-N |
| SMILES | C[C@@H](N)C1CCC(CC1)C(=O)NC1=CC=NC=C1 |
| Size | 25 mg |
| Supplier Page | http://www.adipogen.com/ag-cr1-3564/y-27632-dihydrochloride.html |
