D-(+)-Camphoric acid
Chirality inducing agent. Useful tool as resolving agent to separate the isomers and purify racemic mixtures (e.g. DL-lysine) by fractionally crystallizing the product to obtain the pure isomer (e.g. L-lysine). Can also be used as building block. Insect repellent. Stimulator of osteoblast differentiation.
| Catalog Number | AG-CN2-0461-G001 |
| Alternative Name(s) | (1R,3S)-Camphoric acid; (1R,3S)-1,2,2-Trimethyl-1,3-cyclo-pentanedicarboxylic acid |
| Research Area | Biochemicals |
| Molecular Formula | C10H16O4 |
| CAS# | 124-83-4 |
| Purity | >98% |
| Inchi | InChI=1S/C10H16O4/c1-9(2)6(7(11)12)4-5-10(9,3)8(13)14/h6H,4-5H2,1-3H3,(H,11,12)(H,13,14)/t6-,10+/m1/s1 |
| Inchi Key | LSPHULWDVZXLIL-LDWIPMOCSA-N |
| SMILES | CC1(C)[C@H](CC[C@@]1(C)C(O)=O)C(O)=O |
| Size | 1 g |
| Supplier Page | http://www.adipogen.com/ag-cn2-0461/d-camphoric-acid.html |
