DL-3-Hydroxyisobutyric acid sodium salt
Intermediate formed in the valine catabolism. It is a reactant of the enzymes involved in branched chain amino acid metabolism 3-hydroxyisobutyrate dehydrogenase and 3-hydroxyisobutyryl-CoA hydrolase and it was found to have increased concentrations in MS patient metabolic profiles. This compound may be used to study the distribution, characterization and kinetics of these enzymes. Shown to inhibit key enzymes of the energy metabolism.
| Catalog Number | CDX-H0085-G001 |
| Alternative Name(s) | (±)-Sodium beta-hydroxyisobutyrate; (±)-beta-HIBA-Na; 3-Hydroxy-2-methylpropionic acid sodium salt; Sodium 3-hydroxy-2-methylpropionate |
| Research Area | Biochemicals, Immunology |
| Molecular Formula | C4H7NaO3 |
| CAS# | 1219589-99-7 |
| Purity | >96% |
| Inchi | InChI=1S/C4H8O3.Na/c1-3(2-5)4(6)7;/h3,5H,2H2,1H3,(H,6,7);/q;+1/p-1 |
| Inchi Key | RBJZIQZDAZLXEK-UHFFFAOYSA-M |
| SMILES | CC(CO)C(=O)O[Na] |
| Size | 1 g |
| Supplier Page | http://www.adipogen.com/cdx-h0085/dl-3-hydroxyisobutyric-acid-sodium-salt.html |
