Calphostin C
Potent and highly specific cell permeable protein kinase C (PKC) inhibitor. The inhibition of PKC is light-dependent. PKA, PKG, DAG kinase, phospholipase D1 and D2, myosin light chain kinase and c-Src inhibitor. Anticancer compound. Inhibits cell proliferation and strongly induces apoptosis in vitro. Inducer of endoplasmic reticulum ER-stress. Shown to directly and potently block L-type Ca channels. Calphostin C specifically inhibits contraction-stimulated glucose transport but not insulin-stimulated glucose transport in skeletal muscle. Wnt/beta-catenin/lef-1 signaling inhibitor. beta-catenin/TCF antagonist. Inhibits Wnt-activated genes in a dose-dependent fashion
| Catalog Number | AG-CN2-0430-C100 |
| Alternative Name(s) | UCN 1028C; PKF115-584; Cal-C |
| Research Area | Antibiotic, Apoptosis, Cancer, Immunology, Natural Products |
| Molecular Formula | C44H38O14 |
| CAS# | 121263-19-2 |
| Purity | >95% |
| Inchi | InChI=1S/C44H38O14/c1-20(56-43(50)22-10-8-7-9-11-22)16-25-31-32-26(17-21(2)57-44(51)58-24-14-12-23(45)13-15-24)42(55-6)40(49)34-28(47)19-30(53-4)36(38(32)34)35-29(52-3)18-27(46)33(37(31)35)39(48)41(25)54-5/h7-15,18-21,45-47H,16-17H2,1-6H3 |
| Inchi Key | SRJYZPCBWDVSGO-UHFFFAOYSA-N |
| SMILES | COC1=C2C3=C(OC)C=C(O)C4=C3C(C(CC(C)OC(=O)C3=CC=CC=C3)=C(OC)C4=O)=C3C(CC(C)OC(=O)OC4=CC=C(O)C=C4)=C(OC)C(=O)C(C(O)=C1)=C23 |
| Size | 100 µg |
| Supplier Page | http://www.adipogen.com/ag-cn2-0430/calphostin-c.html |
