Q-VD-OPh
Cell permeable, irreversible and non-toxic non-FMK pan-caspase inhibitor with improved potency, stability and toxicity over Z-VAD-FMK. Does not cross-react with cathepsins nor calpains. Non-toxic due to the 2,6-difluorophenoxy methyl (OPh) group. The peptide is not O-methylated to reduce hydrophobicity and to facilitate use in aqueous media. Inhibits ICE-family protease/caspase processing, leading to apoptosis and autophagy induction. Decreases proteasome activity. Used in apoptosis and inflammasome studies.
| Catalog Number | AG-CP3-0006-M001 |
| Alternative Name(s) | Q-Val-Asp-OPh; pan-Caspase Inhibitor; N-(2-Quinolyl)-L-valyl-L-aspartyl-(2,6-difluorophenoxy) methylketone |
| Research Area | Apoptosis, Autophagy, Biochemicals, Cancer, Cell Death, Inflammasomes, Inflammation, Necrosis, Neurodegenerative Disease |
| Molecular Formula | C26H25F2N3O6 |
| CAS# | 1135695-98-5 (anhydrous) |
| Purity | >95% |
| Inchi | InChI=1S/C26H25F2N3O6/c1-14(2)23(31-25(35)19-11-10-15-6-3-4-9-18(15)29-19)26(36)30-20(12-22(33)34)21(32)13-37-24-16(27)7-5-8-17(24)28/h3-11,14,20,23H,12-13H2,1-2H3,(H,30,36)(H,31,35)(H,33,34)/t20?,23-/m0/s1 |
| Inchi Key | OOBJCYKITXPCNS-AKRCKQFNSA-N |
| SMILES | CC(C)[C@H](NC(=O)C1=CC=C2C=CC=CC2=N1)C(=O)NC(CC(O)=O)C(=O)COC1=C(F)C=CC=C1F |
| Size | 1 mg |
| Supplier Page | http://www.adipogen.com/ag-cp3-0006/q-vd-oph.html |
