IWR-1-endo
Potent and reversible cell permeable Wnt pathway signaling inhibitor. Inhibits Wnt-induced accumulation of beta-catenin, leading to proteasomal degradation of this protein through a destruction complex which consists of Apc, Axin2, CK1 and GSK-3beta. Stabilizes the destruction complex, increasing the level of Axin2 protein without changing the levels of Apc or GSK-3beta. Tankyrase-1 (TNKS1/PARP5a) and Tankyrase-2 (TNKS2/PARP5b) inhibitor (in vitro auto-PARsylation assay).
| Catalog Number | AG-CR1-3581-M005 |
| Alternative Name(s) | 4-[(3aR,4S,7R,7aS)-1,3,3a,4,7,7a-Hexahydro-1,3-dioxo-4,7-methano-2H-isoindol-2-yl]-N-8-quinolinylbenzamide |
| Research Area | Biochemicals, Cancer, Inflammation, Metabolism, Neurodegenerative Disease, Stem Cell Research |
| Molecular Formula | C25H19N3O3 |
| CAS# | 1127442-82-3 |
| Purity | >98% |
| Inchi | InChI=1/C25H19N3O3/c29-23(27-19-5-1-3-14-4-2-12-26-22(14)19)15-8-10-18(11-9-15)28-24(30)20-16-6-7-17(13-16)21(20)25(28)31/h1-12,16-17,20-21H,13H2,(H,27,29)/t16?,17?,20-,21+/f/h27H |
| Inchi Key | ZGSXEXBYLJIOGF-UBYGHTOYDO |
| SMILES | [H][C@@]12C3CC(C=C3)[C@]1([H])C(=O)N(C2=O)C1=CC=C(C=C1)C(=O)NC1=C2N=CC=CC2=CC=C1 |
| Size | 5 mg |
| Supplier Page | http://www.adipogen.com/ag-cr1-3581/iwr-1-endo.html |
