(S)-CR8
Potent cyclin-dependent kinase (CDK) 1, 2, 5, and 9 inhibitor. Apoptosis inducer. Inhibits the proliferation of various cancer cell lines. Inhibits cysts formation in culture. Casein kinase 1 (CK1delta/epsilon) and Dyrk1A inhibitor. Down regulates expression of Mcl-1 and MYCN. Neuroprotective in experimental traumatic brain injury. Potential anti-inflammatory compound. Potential antidiabetic compound.
| Catalog Number | AG-MR-C0004-M010 |
| Alternative Name(s) | 2-(S)-(1-Ethyl-2-hydroxyethylamino)-6-(4-(2-pyridyl)benzyl)-9-isopropylpurine |
| Research Area | Apoptosis, Biochemicals, Cancer, Cell Death, Inflammation, Neurobiology |
| Molecular Formula | C24H29N7O |
| CAS# | 1084893-56-0 |
| Purity | >99% |
| Inchi | InChI=1S/C24H29N7O/c1-4-19(14-32)28-24-29-22(21-23(30-24)31(15-27-21)16(2)3)26-13-17-8-10-18(11-9-17)20-7-5-6-12-25-20/h5-12,15-16,19,32H,4,13-14H2,1-3H3,(H2,26,28,29,30)/t19-/m0/s1 |
| Inchi Key | HOCBJBNQIQQQGT-IBGZPJMESA-N |
| SMILES | CC[C@@H](CO)NC1=NC2=C(N=CN2C(C)C)C(NCC2=CC=C(C=C2)C2=NC=CC=C2)=N1 |
| Size | 10 mg |
| Supplier Page | http://www.adipogen.com/mr-c0004/-s-cr8.html |
