Flusulfamide
Flusulfamide is primarily a soil-applied fungicide. It controls selected myxomycete fungi by preventing germination of both resting spores and secondary zoospores. The mode of action is not clear, however it activity might be attributed to cleavage of key structures within the spore cell walls. Compound can be used as analytical reference material.
| Catalog Number | CDX-F0082-M100 |
| Alternative Name(s) | Nebijin; MTF-651; 4-Chloro-N-(2-chloro-4-nitrophenyl)-3-(trifluoromethyl)benzenesulfonamide |
| Research Area | Biochemicals, Immunology |
| Molecular Formula | C13H7Cl2F3N2O4S |
| CAS# | 106917-52-6 |
| Purity | >98% |
| Inchi | InChI=1S/C13H7Cl2F3N2O4S/c14-10-3-2-8(6-9(10)13(16,17)18)25(23,24)19-12-4-1-7(20(21)22)5-11(12)15/h1-6,19H |
| Inchi Key | GNVDAZSPJWCIQZ-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)C1=CC(Cl)=C(NS(=O)(=O)C2=CC(=C(Cl)C=C2)C(F)(F)F)C=C1 |
| Size | 100 mg |
| Supplier Page | http://www.adipogen.com/cdx-f0082/flusulfamide.html |