Jasplakinolide (high purity)
Cell permeable, non-fluorescent F-actin probe. Potent inducer of actin polymerization and stabilization. Competes with phallotoxins for actin binding. Antifungal and antiparasitic compound. Antiproliferative and anticancer compound. Apoptosis enhancer/inducer. Tool used for autophagy/phagocytosis research.
| Catalog Number | AG-CN2-0037-C050 |
| Alternative Name(s) | Jaspamide; NSC 613009 |
| Research Area | Apoptosis, Cancer, Cell Death, Immunology, Natural Products |
| Molecular Formula | C36H45BrN4O6 |
| CAS# | 102396-24-7 |
| Purity | >98% |
| Inchi | InChI=1S/C36H45BrN4O6/c1-20-15-21(2)17-23(4)47-32(43)19-30(25-11-13-26(42)14-12-25)40-35(45)31(18-28-27-9-7-8-10-29(27)39-33(28)37)41(6)36(46)24(5)38-34(44)22(3)16-20/h7-15,21-24,30-31,39,42H,16-19H2,1-6H3,(H,38,44)(H,40,45)/b20-15+/t21-,22-,23-,24-,30+,31+/m0/s1 |
| Inchi Key | GQWYWHOHRVVHAP-DHKPLNAMSA-N |
| SMILES | C[C@H]1C[C@@H](C)C=C(C)C[C@H](C)C(=O)N[C@@H](C)C(=O)N(C)[C@H](CC2=C(Br)NC3=C2C=CC=C3)C(=O)N[C@H](CC(=O)O1)C1=CC=C(O)C=C1 |
| Size | 50 µg |
| Supplier Page | http://www.adipogen.com/ag-cn2-0037/jasplakinolide.html |
