Amastatin . hydrochloride
Slow, tight binding and competitive aminopeptidase (AP) inhibitor. Inhibits cytosolic leucine aminopeptidase, microsomal aminopeptidase M and bacterial leucine aminopeptidase, human serum aminopeptidase A (AP-A), aminopeptidase N (AP-N), tyrosine aminopeptidase, but not aminopeptidase B (AP-B). Amastatin is without effect on trypsin, papain, chymotrypsin, elastase, pepsin or thermolysin. Inhibits completely the Suc-Ala-Ala-Pro-Leu-pNA amidolytic enzyme. Slightly inhibits the formation of angiotensin III (Ang III) from Angiotensin II through AP-A, but significantly increases the potency of angiotensin III and-angiotensin I. Moderate inhibitor of mitochondrial intermediate peptidase (MIP). Weak inhibitor of simian immunodeficiency virus protease (SIV-PR).
| Catalog Number | AG-CP3-7003-M001 |
| Alternative Name(s) | [(2S,3R)-3-Amino-2-hydroxy-5-methyl-hexanoyl]-Val-Val-Asp-OH . HCl |
| Research Area | Apoptosis, Metabolism |
| Molecular Formula | C21H38N4O8 . HCl |
| CAS# | 100938-10-1 |
| Purity | >98% |
| Inchi | InChI=1S/C21H38N4O8.ClH/c1-9(2)7-12(22)17(28)20(31)25-16(11(5)6)19(30)24-15(10(3)4)18(29)23-13(21(32)33)8-14(26)27;/h9-13,15-17,28H,7-8,22H2,1-6H3,(H,23,29)(H,24,30)(H,25,31)(H,26,27)(H,32,33);1H/t12-,13+,15+,16+,17+;/m1./s1 |
| Inchi Key | GBDUPCKQTDKNLS-PORDUOSCSA-N |
| SMILES | [Cl-].CC(C)C[C@@H]([NH3+])[C@H](O)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](CC(O)=O)C(O)=O |
| Size | 1 mg |
| Supplier Page | http://www.adipogen.com/ag-cp3-7003/amastatin-hydrochloride.html |
