Zinquin ethyl ester
Zinc(II) specific fluorophores probes.
| Catalog Number | CDX-Z0013-M050 |
| Alternative Name(s) | 2-[[2-Methyl-8-[[(4-methylphenyl)sulfonyl]amino]-6-quinolinyl]oxy]-acetic acid ethyl ester |
| Research Area | Biochemicals, Immunology |
| Molecular Formula | C21H22N2O5S |
| CAS# | 181530-09-6 |
| Purity | >99% |
| Inchi | InChI=1S/C21H22N2O5S/c1-4-27-20(24)13-28-17-11-16-8-7-15(3)22-21(16)19(12-17)23-29(25,26)18-9-5-14(2)6-10-18/h5-12,23H,4,13H2,1-3H3 |
| Inchi Key | KCASTCXJTDRDFT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)COC1=CC(NS(=O)(=O)C2=CC=C(C)C=C2)=C2N=C(C)C=CC2=C1 |
| Size | 50 mg |
| Supplier Page | http://www.adipogen.com/cdx-z0013/zinquin-ethyl-ester.html |
