Tetraconazole
Triazole systemic DMI-fungicide (DeMethylation Inhibitor). Mode of action is through inhibition of C14-demethylase, which is important for sterol biosynthesis (erg11/cpy51). Sterols are needed for membrane structure and function, making them essential for the development of functional cell walls. Therefore, these fungicides result in abnormal fungal growth and eventually death. Compound can be used as analytical reference material.
| Catalog Number | CDX-T0115-M500 |
| Alternative Name(s) | (±)-1-[2-(2,4-Dichlorophenyl)-3-(1,1,2,2-tetrafluoroethoxy)propyl]-1H-1,2,4-triazole; (RS)-2-(2,4-Dichlorophenyl)-3-(1H-1,2,4-triazolyl)propyl 1,1,2,2-tetrafluoroethyl ether; Eminent; AG4454 |
| Research Area | Biochemicals, Immunology |
| Molecular Formula | C13H11Cl2F4N3O |
| CAS# | 112281-77-3 |
| Purity | >96% |
| Inchi | InChI=1S/C13H11Cl2F4N3O/c14-9-1-2-10(11(15)3-9)8(4-22-7-20-6-21-22)5-23-13(18,19)12(16)17/h1-3,6-8,12H,4-5H2 |
| Inchi Key | LQDARGUHUSPFNL-UHFFFAOYSA-N |
| SMILES | ClC1=CC=C(C(COC(F)(C(F)F)F)CN2N=CN=C2)C(Cl)=C1 |
| Size | 500 mg |
| Supplier Page | http://www.adipogen.com/cdx-t0115/tetraconazole.html |
