Terpyridine
Reagent for the spectrophotometric det. of Ag and Ru. Tridentate ligand that binds metals at three meridional sites giving two adjacent 5-membered MN2C2 chelate rings. It forms complexes with most transition metal ions. It is also a potent inducer of nitrate and nitric oxide (NO) synthase (iNOS) protein and mRNA production in the cultured murine macrophage RAW 264.7 cell line.
| Catalog Number | CDX-T0113-G005 |
| Alternative Name(s) | 2,2':6',2''-Terpyridine; alpha,alpha′,alpha″-Tripyridyl; 2,6-Di(2-pyridyl)pyridine; NSC36755 |
| Research Area | Biochemicals, Immunology |
| Molecular Formula | C15H11N3 |
| CAS# | 1148-79-4 |
| Purity | >98% |
| Inchi | InChI=1S/C15H11N3/c1-3-10-16-12(6-1)14-8-5-9-15(18-14)13-7-2-4-11-17-13/h1-11H |
| Inchi Key | DRGAZIDRYFYHIJ-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1)C1=NC(=CC=C1)C1=CC=CC=N1 |
| Size | 5 g |
| Supplier Page | http://www.adipogen.com/cdx-t0113/terpyridine.html |
