N-(3-Oxotetradecanoyl)-DL-homoserine lactone
N-(3-Oxotetradecanoyl)-DL-homoserine lactone is a small diffusible signaling molecule and is a member of N-acyl-homoserine lactone family. N-acylhomoserine lactones (AHL) are involved in quorum sensing, controlling gene expression, and cellular metabolism. The diverse applications of this kind of molecule include regulation of virulence in general, infection prevention, and formation of biofilms. It appears later than shorter acyl chain AHLs in developing biofilms and like other long chain 3-oxo-AHLs, stimulates the production of putisolvin, which in turn inhibits biofilm formation.
| Catalog Number | CDX-O0055-M100 |
| Alternative Name(s) | 3-oxo-C14-HSL; 3OC14-HSL; N-3-oxo-Myristoyl-DL-Homoserine lactone |
| Research Area | Biochemicals, Inflammation |
| Molecular Formula | C18H31NO4 |
| CAS# | 503610-29-5 |
| Purity | >97% |
| Inchi | InChI=1S/C18H31NO4/c1-2-3-4-5-6-7-8-9-10-11-15(20)14-17(21)19-16-12-13-23-18(16)22/h16H,2-14H2,1H3,(H,19,21) |
| Inchi Key | YQFJJDSGBAAUPW-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCCCC(=O)CC(=O)NC1CCOC1=O |
| Size | 100 mg |
| Supplier Page | http://www.adipogen.com/cdx-o0055/n-3-oxotetradecanoyl-dl-homoserine-lactone.html |
