7-Methoxycoumarin-3-carboxylic acid
An amine-reactive blue fluorescent probe that provides a distinguishable contrast when used with longer-wavelength probes in certain multicolor fluorescence applications such as nucleic acid and protein microarrays, in situ hybridization and immunofluorescence. This carboxylic acid derivative of 7-methoxycoumarin can be used for coupling to amines, hydrazines or hydroxylamines on biomolecules of interest. Spectral data: Ex=336nm, Em=402nm (Buffer, pH9).
| Catalog Number | CDX-M0016-G005 |
| Alternative Name(s) | 7-Methoxy-2-oxo-2H-1-benzopyran-3-carboxylic acid |
| Research Area | Biochemicals, Immunology |
| Molecular Formula | C11H8O5 |
| CAS# | 20300-59-8 |
| Purity | >97% |
| Inchi | InChI=1S/C11H8O5/c1-15-7-3-2-6-4-8(10(12)13)11(14)16-9(6)5-7/h2-5H,1H3,(H,12,13) |
| Inchi Key | VEEGNDSSWAOLFN-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C=C(C(O)=O)C(=O)O2 |
| Size | 5 g |
| Supplier Page | http://www.adipogen.com/cdx-m0016/7-methoxycoumarin-3-carboxylic-acid.html |
