2-Iodoso-3,4,5,6-tetrafluorobenzoic acid
Hypervalent iodine reagents. Convenient substitute of o-Iodosobenzoic acid (IBA) as an oxidant. Can be used for installations of alpha/beta-unsaturation to carbonyl compounds, oxidations and cyclizations by single-electron transfer processes. Promotes faster reactions than IBA with better solubility in common organic solvents. An attractive feature is the ability to directly measure reactivity by 19F NMR spectroscopy without the use of deuterated solvents.
| Catalog Number | CDX-I0027-G005 |
| Alternative Name(s) | FIBA Tetrafluoro-IBA; 4,5,6,7-Tetrafluoro-1-hydroxy-1,2-benziodoxole-3(1H)-one |
| Research Area | Biochemicals, Immunology |
| Molecular Formula | C7HF4IO3 |
| CAS# | 954373-94-5 |
| Purity | >95% |
| Inchi | InChI=1S/C7HF4IO3/c8-2-1-6(12(14)15-7(1)13)5(11)4(10)3(2)9/h14H |
| Inchi Key | ZJHDTMPJHPTADJ-UHFFFAOYSA-N |
| SMILES | O[I]1OC(=O)C2=C(F)C(F)=C(F)C(F)=C12 |
| Size | 5 g |
| Supplier Page | http://www.adipogen.com/cdx-i0027/2-iodoso-3-4-5-6-tetrafluorobenzoic-acid.html |
