1-Hydroxy-1,2-benziodoxol-3-one 1-oxide pyridinium complex
Stable pyridinium salt of o-iodoxybenzoic acid (PIBX) is a convenient substitute of o-iodoxybenzoic acid (IBX) as an oxidant. PIBX is safer, has neutral properties behaves as an equivalent to IBX in the oxidation of alcohols to ketones or aldehydes in polar solvents and provides higher oxidation rate in THF due to better solubility.
| Catalog Number | CDX-H0104-G005 |
| Alternative Name(s) | IBX pyridine complex; PIBX; Pyridinium o-iodoxybenzoate |
| Research Area | Biochemicals, Immunology |
| Molecular Formula | C12H10INO4 |
| CAS# | 1380548-11-7 |
| Purity | >97% |
| Inchi | InChI=1S/C7H5IO4.C5H5N/c9-7-5-3-1-2-4-6(5)8(10,11)12-7;1-2-4-6-5-3-1/h1-4H,(H,10,11);1-5H |
| Inchi Key | JKZNBOGIALICGN-UHFFFAOYSA-N |
| SMILES | C1=CC=[NH+]C=C1.[O-][I]1(=O)OC(=O)C2=CC=CC=C12 |
| Size | 5 g |
| Supplier Page | http://www.adipogen.com/cdx-h0104/1-hydroxy-1-2-benziodoxol-3-one-1-oxide-pyridinium-complex.html |
