1-Hydroxy-1,2-benziodoxol-3-one
Heterocyclic iodane with catalytic activity in the hydrolytic cleavage of reactive phosphates, phosphonates and carboxylates. Used as catalyst for the micellar cleavage of activated esters and phosphates and shown to be powerful reagent for the cleavage of phosphates in an aqueous cetyltrimethylammonium chloride (CTAC) micellar medium.
| Catalog Number | CDX-H0103-M500 |
| Alternative Name(s) | IBA; o-Iodosobenzoic acid; NSC 364374; BR-43089 |
| Research Area | Biochemicals, Immunology |
| Molecular Formula | C7H5IO3 |
| CAS# | 131-62-4 |
| Purity | >98% |
| Inchi | InChI=1S/C7H5IO3/c9-7-5-3-1-2-4-6(5)8(10)11-7/h1-4,10H |
| Inchi Key | AZJIXRYFAZOEMC-UHFFFAOYSA-N |
| SMILES | O[I]1OC(=O)C2=CC=CC=C12 |
| Size | 500 mg |
| Supplier Page | http://www.adipogen.com/cdx-h0103/1-hydroxy-1-2-benziodoxol-3-one.html |
