Halofenozide
Dibenzoylhydrazine based nonsteroidal insecticide. Ecdysone agonist that mimics the biological function of the natural insect molting hormone 20-hydroxyecdysone, causing premature molting and interfering with the normal growth and development in insects. Ecdysteroid agonist are also used as ligands for gene expression and gene therapy research. Compound can be used as analytical reference material.
| Catalog Number | CDX-H0097-M250 |
| Alternative Name(s) | RG 100864; RH 0345; N-tert-Butyl-N′-(4-chlorobenzoyl)benzohydrazide |
| Research Area | Biochemicals, Immunology |
| Molecular Formula | C18H19ClN2O2 |
| CAS# | 112226-61-6 |
| Purity | >98% |
| Inchi | InChI=1S/C18H19ClN2O2/c1-18(2,3)21(17(23)14-7-5-4-6-8-14)20-16(22)13-9-11-15(19)12-10-13/h4-12H,1-3H3,(H,20,22) |
| Inchi Key | CNKHSLKYRMDDNQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N(NC(=O)C1=CC=C(Cl)C=C1)C(=O)C1=CC=CC=C1 |
| Size | 250 mg |
| Supplier Page | http://www.adipogen.com/cdx-h0097/halofenozide.html |
