DL-3-Hydroxybutyric acid sodium salt
Neuroprotective compound in experimental models of neurodegenerative diseases. Shown to be oxidized as an energetic substrate in the brain during starvation. May inhibit brain glucose oxidation, which may account for the suppression of hepatic glucose production observed after administration of ketone bodies in humans.
| Catalog Number | CDX-H0080-G010 |
| Alternative Name(s) | Sodium 3-hydroxybutyrate; beta-Hydroxybutyrate sodium salt |
| Research Area | Biochemicals, Inflammation |
| Molecular Formula | C4H7NaO3 |
| CAS# | 150-83-4 |
| Purity | >98% |
| Inchi | InChI=1S/C4H8O3.Na/c1-3(5)2-4(6)7;/h3,5H,2H2,1H3,(H,6,7);/q;+1/p-1 |
| Inchi Key | NBPUSGBJDWCHKC-UHFFFAOYSA-M |
| SMILES | [Na+].CC(O)CC([O-])=O |
| Size | 10 g |
| Supplier Page | http://www.adipogen.com/cdx-h0080/dl-3-hydroxybutyric-acid-sodium-salt.html |
