5-Hydroxynicotinic acid
A nicotinic acid analog. Substrate analog MHPCO, used in the investigation of the hydroxylation mechanism of the flaovoprotein 2-methyl-3-hydroxypyridine-5-carboxylic acid oxygenase (MHPCO). Also used as building block for synthesis. Hydroxynicotinic acid is formed by the enzymatic action of nicotinate with nicotinic acid hydroxylase or nicotinate hydroxylase.
| Catalog Number | CDX-H0052-G001 |
| Alternative Name(s) | 5-Hydroxypyridine-3-carboxylic acid |
| Research Area | Biochemicals, Immunology |
| Molecular Formula | C6H5NO3 |
| CAS# | 27828-71-3 |
| Purity | >97% |
| Inchi | InChI=1S/C6H5NO3/c8-5-1-4(6(9)10)2-7-3-5/h1-3,8H,(H,9,10) |
| Inchi Key | ATTDCVLRGFEHEO-UHFFFAOYSA-N |
| SMILES | OC(=O)C1=CC(O)=CN=C1 |
| Size | 1 g |
| Supplier Page | http://www.adipogen.com/cdx-h0052/5-hydroxynicotinic-acid.html |