4-Hydroxyphenylpyruvic acid
Keto acid that is involved in the tyrosine catabolism pathway. It is a product of the enzyme (R)-4-hydroxyphenyllactate dehydrogenase and is formed during tyrosine metabolism. The conversion from tyrosine to 4-HPPA is catalyzed by tyrosine aminotransferase. 4-HPPA can be converted to homogentisic acid which is one of the precursors to ochronotic pigment. A deficiency in the catalytic activity of HPD is known to lead to tyrosinemia type III, an autosomal recessive disorder characterized by elevated levels of blood tyrosine and massive excretion of tyrosine derivatives into urine.
| Catalog Number | CDX-H0013-G005 |
| Alternative Name(s) | 3-(4-Hydroxyphenyl)-2-oxopropanoic acid; 4-HPPA; p-Hydroxyphenylpyruvic acid |
| Research Area | Biochemicals, Immunology |
| Molecular Formula | C9H8O4 |
| CAS# | 156-39-8 |
| Purity | >98% |
| Inchi | InChI=1S/C9H8O4/c10-7-3-1-6(2-4-7)5-8(11)9(12)13/h1-4,10H,5H2,(H,12,13) |
| Inchi Key | KKADPXVIOXHVKN-UHFFFAOYSA-N |
| SMILES | OC(=O)C(=O)CC1=CC=C(O)C=C1 |
| Size | 5 g |
| Supplier Page | http://www.adipogen.com/cdx-h0013/4-hydroxyphenylpyruvic-acid.html |
