Flupyrsulfuron-methyl sodium
Systemic and slective herbicide. Mode of action is through inhibition of acetolactate synthase ALS (acetohydroxyacid synthase AHAS), which causes a blockade of the biosynthesis of amino acids with branched side chains, such as L-Leucin, L-Isoleucin and L-Valin. Compound can be used as analytical reference material.
| Catalog Number | CDX-F0083-M025 |
| Alternative Name(s) | Methyl 2-[(4,6-dimethoxypyrimidin-2-ylcarbamoyl)sulfamoyl]-6-(trifluoromethyl)nicotinate monosodium salt |
| Research Area | Biochemicals, Immunology |
| Molecular Formula | C15H13F3N5NaO7S |
| CAS# | 144740-54-5 |
| Purity | >98% |
| Inchi | InChI=1S/C15H14F3N5O7S.Na/c1-28-9-6-10(29-2)21-13(20-9)22-14(25)23-31(26,27)11-7(12(24)30-3)4-5-8(19-11)15(16,17)18;/h4-6H,1-3H3,(H2,20,21,22,23,25);/q;+1/p-1 |
| Inchi Key | JKPSVOHVUGMYGH-UHFFFAOYSA-M |
| SMILES | O=C([N-]S(C1=NC(C(F)(F)F)=CC=C1C(OC)=O)(=O)=O)NC2=NC(OC)=CC(OC)=N2.[Na+] |
| Size | 25 mg |
| Supplier Page | http://www.adipogen.com/cdx-f0083/flupyrsulfuron-methyl-sodium.html |
