DAR-2 Solution
Sensitive NO probe, LOD of 10 nM, shows higher photostability than the classical fluorescein derivative DAF. Spectral data: lambdaex 562nm; lambdaem 579nm in 0.1 M phosphate pH 7.4.
| Catalog Number | CDX-D0602-M001 |
| Alternative Name(s) | 5,6-Diamino-rhodamine B; 5,6-Diamino-N,N,N',N'-tetraethylrhodamine |
| Research Area | Biochemicals, Immunology |
| Molecular Formula | C28H32N4O3 |
| CAS# | 261351-45-5 |
| Purity | >97% |
| Inchi | InChI=1S/C28H32N4O3/c1-5-31(6-2)17-9-11-20-25(13-17)34-26-14-18(32(7-3)8-4)10-12-21(26)28(20)22-16-24(30)23(29)15-19(22)27(33)35-28/h9-16H,5-8,29-30H2,1-4H3 |
| Inchi Key | LJSMMWFTVBPRDS-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1=CC2=C(C=C1)C1(OC(=O)C3=C1C=C(N)C(N)=C3)C1=CC=C(C=C1O2)N(CC)CC |
| Size | 1 mg |
| Supplier Page | http://www.adipogen.com/cdx-d0602/dar-2-solution.html |
