N-Dodecanoyl-DL-homoserine lactone
N-Dodecanoyl-DL-homoserine lactone (C12-HSL) is a small diffusible signalling molecule involved in quorum sensing, thereby controlling gene expression and affecting cellular metabolism in bacteria. In addition to regulating bacterial functions, C12-HSL activates NF-kappaB in RAW 264.7 macrophages, increasing the expression of TNF-alpha, interleukin-1beta (IL-1beta) and IL-8, while other lactones do not. In addition, C12-HSL alters cell cycling and metabolism of human keratinocyte (HaCaT) cells. It also was shown to induce cell death by apoptosis.
| Catalog Number | CDX-D0339-M010 |
| Alternative Name(s) | C12-HSL; N-(2-Oxotetrahydro-3-furanyl)dodecanamide; N-Lauroyl-DL-homoserine lactone |
| Research Area | Biochemicals, Inflammation |
| Molecular Formula | C16H29NO3 |
| CAS# | 18627-38-8 |
| Purity | >97% |
| Inchi | InChI=1S/C16H29NO3/c1-2-3-4-5-6-7-8-9-10-11-15(18)17-14-12-13-20-16(14)19/h14H,2-13H2,1H3,(H,17,18) |
| Inchi Key | WILLZMOKUUPJSL-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCCCC(=O)NC1CCOC1=O |
| Size | 10 mg |
| Supplier Page | http://www.adipogen.com/cdx-d0339/n-dodecanoyl-dl-homoserine-lactone.html |
