N-Dodecanoyl-L-homoserine lactone
N-Dodecanoyl-L-homoserine lactone (C12-HSL) is a small diffusible signalling molecule involved in quorum sensing, thereby controlling gene expression and affecting cellular metabolism in bacteria. In addition to regulating bacterial functions, C12-HSL activates NF-kappaB in RAW 264.7 macrophages, increasing the expression of TNF-alpha, interleukin-1beta (IL-1beta) and IL-8, while other lactones do not. In addition, C12-HSL alters cell cycling and metabolism of human keratinocyte (HaCaT) cells. It is important to note that C12-HSL is distinct from N-3-oxo-dodecanoyl-L-homoserine lactone, which is produced at different times in biofilm development and has different cellular effects.
| Catalog Number | CDX-D0335-M050 |
| Alternative Name(s) | N-[(3S)-Tetrahydro-2-oxo-3-furanyl]-dodecanamide; dDHL; C12-HSL |
| Research Area | Biochemicals, Immunology, Inflammation |
| Molecular Formula | C16H29NO3 |
| CAS# | 137173-46-7 |
| Purity | >98% |
| Inchi | InChI=1S/C16H29NO3/c1-2-3-4-5-6-7-8-9-10-11-15(18)17-14-12-13-20-16(14)19/h14H,2-13H2,1H3,(H,17,18)/t14-/m0/s1 |
| Inchi Key | WILLZMOKUUPJSL-AWEZNQCLSA-N |
| SMILES | CCCCCCCCCCCC(=O)N[C@H]1CCOC1=O |
| Size | 50 mg |
| Supplier Page | http://www.adipogen.com/cdx-d0335/n-dodecanoyl-l-homoserine-lactone.html |
