1,7-Dimethyluric acid
A metabolite of caffeine with antioxidant and neuroprotective activities. Does not inhibit the differentiation of 3T3-L1 pre-adipocytes to mature adipocytes, but suppress the intracellular lipid accumulation after complete differentiation in a dose-dependent manner.
| Catalog Number | CDX-D0295-M050 |
| Alternative Name(s) | 17U; 1,7-DMUA; 1,7-Dimethyl-1H-purine-2,6,8(3H,7H,9H)-trione |
| Research Area | Biochemicals, Inflammation |
| Molecular Formula | C7H8N4O3 |
| CAS# | 33868-03-0 |
| Purity | >98% |
| Inchi | InChI=1S/C7H8N4O3/c1-10-3-4(8-6(10)13)9-7(14)11(2)5(3)12/h1-2H3,(H,8,13)(H,9,14) |
| Inchi Key | NOFNCLGCUJJPKU-UHFFFAOYSA-N |
| SMILES | CN1C(=O)NC2=C1C(=O)N(C)C(=O)N2 |
| Size | 50 mg |
| Supplier Page | http://www.adipogen.com/cdx-d0295/1-7-dimethyluric-acid.html |