Dihydrofluorescein diacetate
Dihydrofluorescein diacetate is a fluorescent probe for detecting intracellular oxidants. It is hydrolyzed by cellular esterases to dihydrofluorescein and is then oxidized to fluorescein primarily by H2O2. Dihydrofluorescein diacetate might be reactive toward a broad range of oxidizing reactions that may be increased during intracellular oxidant stress. Cell-loading studies indicate that dihydrofluorescein achieves higher intracellular concentrations than the other redox sensors such as Dihydrorhodamine 123 (Ex/Em: 490/514nm).
| Catalog Number | CDX-D0122-G001 |
| Research Area | Biochemicals, Immunology |
| Molecular Formula | C24H18O7 |
| CAS# | 35340-49-9 |
| Purity | >97% |
| Inchi | InChI=1S/C24H18O7/c1-13(25)29-15-7-9-19-21(11-15)31-22-12-16(30-14(2)26)8-10-20(22)23(19)17-5-3-4-6-18(17)24(27)28/h3-12,23H,1-2H3,(H,27,28) |
| Inchi Key | YKSJJXGQHSESKB-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC2=C(C=C1)C(C1=C(O2)C=C(OC(C)=O)C=C1)C1=C(C=CC=C1)C(O)=O |
| Size | 1 g |
| Supplier Page | http://www.adipogen.com/cdx-d0122/dihydrofluorescein-diacetate.html |
