(-)-Cytisine
Pyridine-like alkaloid. Nicotine agonist. Potent agonist at alpha3beta4 and alpha7 nicotinic acetylcholine receptors and partial agonist at alpha4beta2 nicotinic acetylcholine receptors. Shows analgesic, antihypertensive and inotropic activities. Used for smoking cessation. Iron-chelator and hydroxyl radical scavanger. Has antidepressant properties. Used in forensics in novel surface molecular imprinting techniques.
| Catalog Number | CDX-C0228-G005 |
| Alternative Name(s) | NSC 407282; BRN 0083882; Baptitoxine; Sophorine; (1S,5R)-3,4,5,6-tetrahydro-1H-1,5-methanopyrido[1,2-a][1,5]diazocin-8(2H)-one |
| Research Area | Biochemicals, Inflammation |
| Molecular Formula | C11H14N2O |
| CAS# | 485-35-8 |
| Purity | >99% |
| Inchi | InChI=1S/C11H14N2O/c14-11-3-1-2-10-9-4-8(5-12-6-9)7-13(10)11/h1-3,8-9,12H,4-7H2/t8-,9+/m0/s1 |
| Inchi Key | ANJTVLIZGCUXLD-DTWKUNHWSA-N |
| SMILES | O=C1C=CC=C2[C@@H]3CNCC(C3)CN12 |
| Size | 5 g |
| Supplier Page | http://www.adipogen.com/cdx-c0228/-cytisine.html |
