6-CFDA N-succinimidyl ester
6-CFDA is membrane-permeant and thus can be loaded into cells via incubation. Once inside the cells, 6-CFDA is hydrolyzed by intracellular esterases to 6-carboxyfluorescein. Reagent for continuously determining the intracellular pH in bacteria by fluorometry. Labeling human intervertebral disk cells in vitro for fluorescence microscopy.
| Catalog Number | CDX-C0095-M100 |
| Alternative Name(s) | 6-Carboxyfluorescein diacetate N-succinimidyl ester |
| Research Area | Biochemicals, Immunology |
| Molecular Formula | C29H19NO11 |
| CAS# | 150206-15-8 |
| Purity | >90% |
| Inchi | InChI=1S/C29H19NO11/c1-14(31)37-17-4-7-20-23(12-17)39-24-13-18(38-15(2)32)5-8-21(24)29(20)22-11-16(3-6-19(22)28(36)40-29)27(35)41-30-25(33)9-10-26(30)34/h3-8,11-13H,9-10H2,1-2H3 |
| Inchi Key | JGPOSNWWINVNFV-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC2=C(C=C1)C1(OC(=O)C3=C1C=C(C=C3)C(=O)ON1C(=O)CCC1=O)C1=CC=C(OC(C)=O)C=C1O2 |
| Size | 100 mg |
| Supplier Page | http://www.adipogen.com/cdx-c0095/6-cfda-n-succinimidyl-ester.html |
