5(6)-CFDA
CFDA is a popular, sensitive, fluorescent substrate for measuring esterase activity in live cells. It is often used in cell viability assays and “Live-Dead” assay systems, especially automated cell viability assays. The cleavage product produced upon enzymatic or chemical hydrolysis of the acetate group(s) is carboxyfluorescein which is well-retained inside live cells, while the substrate CFDA is membrane permeant.
| Catalog Number | CDX-C0046-M025 |
| Alternative Name(s) | 5(6)-Carboxyfluorescein diacetate |
| Research Area | Biochemicals, Immunology |
| Molecular Formula | C25H16O9 |
| CAS# | 124387-19-5 |
| Purity | >90% |
| Inchi | InChI=1S/C24H16O7.C2H4O2/c1-13(25)28-15-7-9-19-21(11-15)30-22-12-16(29-14(2)26)8-10-20(22)24(19)18-6-4-3-5-17(18)23(27)31-24;1-2(3)4/h3-12H,1-2H3;1H3,(H,3,4) |
| Inchi Key | DCPDRLHHNBUQPJ-UHFFFAOYSA-N |
| SMILES | CC(O)=O.CC(=O)OC1=CC2=C(C=C1)C1(OC(=O)C3=C1C=CC=C3)C1=CC=C(OC(C)=O)C=C1O2 |
| Size | 25 mg |
| Supplier Page | http://www.adipogen.com/cdx-c0046/5-6-cfda.html |
