3-Carboxy-6,8-difluoro-7-hydroxycoumarin
This amine-reactive reagent can be used to create blue-fluorescent bioconjugates with excitation/emission maxima ~410/455 nm that are excitable by the 405 nm spectral line of the blue diode (violet) laser. Used in highly sensitive analyses of amines, amino acids and dipeptides. Amine-reactive reagents react with non-protonated aliphatic amine groups, including the amine terminus of proteins and the є-amino group of lysines.
| Catalog Number | CDX-C0036-M100 |
| Alternative Name(s) | NHS Pacific Blue succinimidyl ester; 2,5-Dioxopyrrolidin-1-yl 6,8-difluoro-7-hydroxy-2-oxo-2H-chromene-3-carboxylate |
| Research Area | Biochemicals, Immunology |
| Molecular Formula | C14H7F2NO7 |
| CAS# | 215868-33-0 |
| Purity | >98% |
| Inchi | InChI=1S/C14H7F2NO7/c15-7-4-5-3-6(13(21)23-12(5)10(16)11(7)20)14(22)24-17-8(18)1-2-9(17)19/h3-4,20H,1-2H2 |
| Inchi Key | NZYXABPVYJRICY-UHFFFAOYSA-N |
| SMILES | OC1=C(F)C2=C(C=C1F)C=C(C(=O)ON1C(=O)CCC1=O)C(=O)O2 |
| Size | 100 mg |
| Supplier Page | http://www.adipogen.com/cdx-c0036/3-carboxy-6-8-difluoro-7-hydroxycoumarin.html |
