N-Biotinyl-NH-(PEG)2-COOH . DIPEA
Functionalized biotin. Biotinylated polyethylene glycol (PEG-Biotin) is an avidine or streptavidin reactive PEG derivative that can be used to modify biomolecues or other surfaces through biotin-streptavidin interaction. Used for addition of biotin-PEG to the N-terminus of resin-bound peptides. Can be introduced using standard coupling methods, such as PyBOP or TBTU and has better solubility in DMF and NMP than comparable non-PEG-containing derivatives, such as biotin-Ahx and biocytin.
| Catalog Number | CDX-B0209-M250 |
| Alternative Name(s) | O-(N-Biotinyl-3-aminopropyl)-O'-(N-glutaryl-3-aminopropyl)-diethyleneglycol . DIPEA; COOH-PEG-Biotin |
| Research Area | Biochemicals, Immunology |
| Molecular Formula | C25H44N4O8S . C8H19N |
| CAS# | 1205744-09-7 |
| Purity | >95% |
| Inchi | InChI=1S/C25H44N4O8S.C8H19N/c30-21(7-2-1-6-20-24-19(18-38-20)28-25(34)29-24)26-10-4-12-35-14-16-37-17-15-36-13-5-11-27-22(31)8-3-9-23(32)33;1-6-9(7(2)3)8(4)5/h19-20,24H,1-18H2,(H,26,30)(H,27,31)(H,32,33)(H2,28,29,34);7-8H,6H2,1-5H3/t19-,20-,24-;/m0./s1 |
| Inchi Key | QHGWMUWTURKJLL-GWCCHDLDSA-N |
| SMILES | CCN(C(C)C)C(C)C.[H][C@]12CS[C@@H](CCCCC(=O)NCCCOCCOCCOCCCNC(=O)CCCC(O)=O)[C@@]1([H])NC(=O)N2 |
| Size | 250 mg |
| Supplier Page | http://www.adipogen.com/cdx-b0209/n-biotinyl-nh-peg-2-cooh-dipea.html |
