DAF-FM Solution
DAF-FM is an important reagent for quantitating low concentrations of nitric oxide in solution. This compound is essentially nonfluorescent until it reacts with NO to form a fluorescent benzotrizole. With excitation/emission maxima of 495/515 nm and a dectection limit of 3 nM, DAF-FM can be detected using any instrument that can be used to detect fluorescein. It is more photo-stable and less pH sensitive than DAF-2.
| Catalog Number | CDX-A0523-M001 |
| Alternative Name(s) | Diaminofluorescein-FM; 4-Amino-5-methylamino-2',7'-difluorofluorescein |
| Research Area | Biochemicals, Immunology |
| Molecular Formula | C21H14F2N2O5 |
| CAS# | 254109-20-1 |
| Purity | >98% |
| Inchi | InChI=1S/C21H14F2N2O5/c1-25-13-3-2-8(19(20(13)24)21(28)29)18-9-4-11(22)14(26)6-16(9)30-17-7-15(27)12(23)5-10(17)18/h2-7,25-26H,24H2,1H3,(H,28,29) |
| Inchi Key | BJTLSPOVXMBXRZ-UHFFFAOYSA-N |
| SMILES | CNC1=C(N)C(C(O)=O)=C(C=C1)C1=C2C=C(F)C(=O)C=C2OC2=C1C=C(F)C(O)=C2 |
| Size | 1 mg |
| Supplier Page | http://www.adipogen.com/cdx-a0523/daf-fm-solution.html |