Cephalochromin
Mycotoxin. Bis(naphtha-gamma-pyrone) derivative similar to chaetochromin and ustilaginoidin. Antibiotic. Antibacterial, antifungal and anti-algal compound. Antitumor and cytotoxic compound. Calmodulin-sensitive PDE activity inhibitor. Inhibits NO production by activated macrophages. Selective Fabl (bacterial enoyl-acyl carrier protein (ACP) reductase) inhibitor. Inducer of G0/G1 cell cycle arrest and apoptosis in human A549 cells.
| Catalog Number | BVT-0440-M001 |
| Alternative Name(s) | Cefalochromin; NSC201419; NSC627953; Antibiotic Sch45752; 2,2',3,3'-Tetrahydro-5,5',6,6',8,8'-hexahydroxy-2,2'-dimethyl-9,9'-bi[4H-naphtho[2,3-b]pyran]-4,4'-dione |
| Research Area | Cancer, Inflammation, Natural Products |
| Molecular Formula | C28H22O10 |
| CAS# | 25908-26-3 |
| Purity | >98% |
| Inchi | InChI=1S/C28H22O10/c1-9-4-15(30)25-19(37-9)6-12-11(5-18(33)26(34)23(12)28(25)36)21-13-7-20-24(14(29)3-10(2)38-20)27(35)22(13)17(32)8-16(21)31/h5-10,31-36H,3-4H2,1-2H3 |
| Inchi Key | FCPNXYHPAIZMNJ-UHFFFAOYSA-N |
| SMILES | CC1CC(=O)C2=C(O)C3=C(C=C2O1)C(=CC(O)=C3O)C1=C(O)C=C(O)C2=C1C=C1OC(C)CC(=O)C1=C2O |
| Size | 1 mg |
| Supplier Page | http://www.adipogen.com/bvt-0440/cephalochromin.html |
