Helvolic acid
Steroidal triterpene. Antibiotic. Antibacterial. Shows broad activity against Gram positive and negative bacteria. Mycotoxin. Antifungal. Oxidized LDL uptake inhibitor. Phytotoxin. Inhibitor of the protein biosynthesis through archeal elongation factor 2 (EF-2).
| Catalog Number | BVT-0435-M001 |
| Alternative Name(s) | Fumigacin; NSC 319943; BRN 3230584 |
| Research Area | Antibiotic, Immunology, Inflammation, Metabolism, Natural Products |
| Molecular Formula | C33H44O8 |
| CAS# | 29400-42-8 |
| Purity | >96% |
| Inchi | InChI=1S/C33H44O8/c1-17(2)10-9-11-21(30(38)39)26-22-12-13-25-31(6)15-14-23(36)18(3)27(31)28(41-20(5)35)29(37)33(25,8)32(22,7)16-24(26)40-19(4)34/h10,14-15,18,22,24-25,27-28H,9,11-13,16H2,1-8H3,(H,38,39)/b26-21-/t18?,22?,24-,25?,27?,28-,31+,32-,33?/m0/s1 |
| Inchi Key | MDFZYGLOIJNNRM-ADZJIBGLSA-N |
| SMILES | [H]C12CCC3[C@@]4(C)C=CC(=O)C(C)C4([H])[C@H](OC(C)=O)C(=O)C3(C)[C@@]1(C)C[C@H](OC(C)=O)C2=C(CCC=C(C)C)C(O)=O |
| Size | 1 mg |
| Supplier Page | http://www.adipogen.com/bvt-0435/helvolic-acid.html |
