Fumitremorgin C
Mycotoxin. Cytotoxic. Tremorgenic. Potent and specific inhibitor of the breast cancer resistance protein (BCRP; ABCG2). Reverses multidrug resistance mediated by BCRP and increases cytotoxicity of several anticancer agents in vitro.
| Catalog Number | BVT-0189-M001 |
| Alternative Name(s) | FTC; Tryptoquivaline |
| Research Area | Cancer, Natural Products |
| Molecular Formula | C22H25N3O3 |
| CAS# | 118974-02-0 |
| Purity | >98% |
| Inchi | InChI=1S/C22H25N3O3/c1-12(2)9-18-20-15(14-7-6-13(28-3)10-16(14)23-20)11-19-21(26)24-8-4-5-17(24)22(27)25(18)19/h6-7,9-10,17-19,23H,4-5,8,11H2,1-3H3/t17-,18-,19-/m0/s1 |
| Inchi Key | DBEYVIGIPJSTOR-FHWLQOOXSA-N |
| SMILES | [H][C@@]12CCCN1C(=O)[C@]1([H])CC3=C(NC4=C3C=CC(OC)=C4)[C@H](C=C(C)C)N1C2=O |
| Size | 1 mg |
| Supplier Page | http://www.adipogen.com/bvt-0189/fumitremorgin-c.html |
