Carbamoylcholine chloride
Acetylcholine analog that activates acetylcholine receptors (AChR). Non-selective agonist of nicotinic (nAChR) and muscarinic (mAChR) receptors that is resistant to the action of cholinesterases. Used to study responses mediated by nAChR and mAChR, including smooth muscle contraction, gut motility and neuronal signaling. Shown to inhibit apoptotic death of cultured neurons.
| Catalog Number | AG-CR1-3649-G001 |
| Alternative Name(s) | Carbachol; (2-Hydroxyethyl)trimethylammonium chloride carbamate |
| Research Area | Biochemicals, Cancer, Cell Death, Neurobiology |
| Molecular Formula | C6H15N2O2 . Cl |
| CAS# | 51-83-2 |
| Purity | >98% |
| Inchi | InChI=1S/C6H14N2O2.ClH/c1-8(2,3)4-5-10-6(7)9;/h4-5H2,1-3H3,(H-,7,9);1H |
| Inchi Key | AIXAANGOTKPUOY-UHFFFAOYSA-N |
| SMILES | NC(OCC[N+](C)(C)C)=O.[Cl-] |
| Size | 1 g |
| Supplier Page | http://www.adipogen.com/ag-cr1-3649/carbamoylcholine-chloride.html |
